Quaternary ammonium salts
Medchemexpress LLC O-Acetyl-L-carnitine | 3040-38-8 | 99.86% | 203.24 | 1 ML
O-Acetyl-L-carnitine | 3040-38-8 | 99.86% | 203.24 | 1 ML
Medchemexpress LLC Valeryl-L-carnitine-d3 chloride | 162040-64-4 | >99.9% | 284.79 | 1 MG
Valeryl-L-carnitine-d3 (chloride) is a deuterium labeled version of Valeryl-L-carnitine chloride. It serves as a tracer and internal standard for quantitative analysis using techniques like NMR, GC-MS, or LC-MS. Stable heavy isotopes of elements such as hydrogen and carbon are incorporated into drug molecules primarily for quantitation during drug development, and deuteration can influence the pharmacokinetic and metabolic profiles of drugs.
- Used as a tracer and internal standard
- Applicable for quantitative analysis by NMR, GC-MS, or LC-MS
- Incorporates stable heavy isotopes for drug development
- Deuteration can affect pharmacokinetic and metabolic profiles
Apexbio Technology LLC /-CARNITINE-D9-CHLORIDE-5MG
( )-Carnitine-d9 chloride (CAS No 1219386-75-0) is a compound used in biomedical research primarily to study metabolic processes and energy production pathways As a derivative of carnitine it plays a role in the transport of fatty acids into mitochondria for beta-oxidation which is crucial for energy production Research focuses on its impact at the cellular level often evaluating in vitro activity in the nanomolar to low micromolar range Commonly used in cell models and animal studies ( )-Carnitine-d9 chloride aids in drug screening and metabolic research including studies related to muscle function and energy metabolism Experimental concentrations typically depend on the specific research design
Apexbio Technology LLC Octadecanoyl-carnitine-d3-HCl
Octadecanoyl carnitine-d3 HCl is a deuterated fatty acid ester involved in biomedical research primarily focused on lipid metabolism and transport mechanisms Originating from studies of acylcarnitines it is instrumental in examining fatty acid oxidation pathways and mitochondrial function This compound targets carnitine acyltransferases playing a crucial role in translocating acyl groups across cellular membranes Its activity is commonly assessed in the nanomolar to low micromolar range This makes it a valuable tool for in vitro assays involving various cell models including those related to metabolic disorders Additionally it is utilized in animal studies to explore its potential effects on energy metabolism and lipid-related conditions Drug screening efforts employ it to evaluate new therapeutic candidates targeting metabolic pathways Experimental concentrations typically depend on the specific research design employed ensuring relevance and accuracy in findings
Medchemexpress LLC N-hexanoyl-DL-homoserine lactone | 106983-28-2 | 98.0% | 199.25 | C10H17NO3 | 25 MG
N-hexanoyl-DL-homoserine lactone is an N-acyl homoserine lactone (AHL) quorum sensing signaling molecule used in research to study bacterial communication and related biological effects.
- Used to study quorum sensing and bacterial signaling.
- Available as a solid and as a 10 mM solution in DMSO.
- Reported purity 98.0%.
- Molecular formula C10H17NO3 and molecular weight 199.25.
- Provided in multiple packaging sizes including 25 mg.
Medchemexpress LLC Acetyl-L-carnitine hydrochloride (standard) | 5080-50-2 | 99.9% | 5 MG
Acetyl-L-carnitine hydrochloride (standard) | 5080-50-2 | 99.9% | 5 MG
![eMolecules 22206-57-1 | Tetrabutylammonium fluoride hydrate | Oakwood Chemicals | MFCD00149980 | 279.484 | C16H38FNO | 98.000 | O.[F-].CCCC[N+](CCCC)(CCCC)CCCC | 500g | 480145346](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000159397.jpg-250.jpg)
eMolecules 22206-57-1 | Tetrabutylammonium fluoride hydrate | Oakwood Chemicals | MFCD00149980 | 279.484 | C16H38FNO | 98.000 | O.[F-].CCCC[N+](CCCC)(CCCC)CCCC | 500g | 480145346
Tetrabutylammonium fluoride hydrate | Oakwood Chemicals | 22206-57-1 | MFCD00149980 | 279.484 | C16H38FNO | 98.000 | O.[F-].CCCC[N+](CCCC)(CCCC)CCCC | 500g | 480145346
![eMolecules 32503-27-8 | Tetrabutylammonium hydrogensulfate | Chem-Impex | MFCD00011637 | 339.540 | C16H37NO4S | 99.000 | OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC | 25g | 322127011](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000159460.jpg-250.jpg)
eMolecules 32503-27-8 | Tetrabutylammonium hydrogensulfate | Chem-Impex | MFCD00011637 | 339.540 | C16H37NO4S | 99.000 | OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC | 25g | 322127011
Tetrabutylammonium hydrogensulfate | Chem-Impex | 32503-27-8 | MFCD00011637 | 339.540 | C16H37NO4S | 99.000 | OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC | 25g | 322127011
Pfaltz & Bauer S-Acetylthiocholine iodide, 98 1G | 1866-15-5
S-Acetylthiocholine iodide, 98 1G | 1866-15-5
![eMolecules 32503-27-8 | Tetrabutylammonium hydrogen sulfate, for ion pair chromatography for HPLC | Oakwood Chemicals | MFCD00011637 | 339.540 | C16H37NO4S | 99.000 | OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC | 5g | 480153364](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000473120.jpg-250.jpg)
eMolecules 32503-27-8 | Tetrabutylammonium hydrogen sulfate, for ion pair chromatography for HPLC | Oakwood Chemicals | MFCD00011637 | 339.540 | C16H37NO4S | 99.000 | OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC | 5g | 480153364
Tetrabutylammonium hydrogen sulfate, for ion pair chromatography for HPLC | Oakwood Chemicals | 32503-27-8 | MFCD00011637 | 339.540 | C16H37NO4S | 99.000 | OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC | 5g | 480153364